POTASSIUM (4-CARBOXYPHENYL)TRIFLUOROBORATE
POTASSIUM (4-CARBOXYPHENYL)TRIFLUOROBORATE is an indispensable component extensively employed in the biomedical field. It showcases remarkable versatility as a reagent in organic synthesis and catalysis. Its pivotal role in pharmaceutical drug manufacturing, notably targeting a plethora of maladies such as cancers, infections, and cardiovascular afflictions, exemplifies its invaluable significance. Its distinctive characteristics render it a paramount instrument wielded by medicinal chemists and drug discovery scientists.
| Supplier | BOC Sciences |
|---|---|
| Product # | 850623-38-0 |
| Pricing | Inquire |
| Cas | 850623-38-0 |
| Molecular Weight | 228.02 |
| Molecular Formula | C7H5BF3KO2 |
| Canonical SMILES | [B-](C1=CC=C(C=C1)C(=O)O)(F)(F)F.[K+] |