Carbidopa-[d5]
Carbidopa-[d5], is the labelled analogue of Carbidopa. Carbidopa is a drug given to people with Parkinson's disease in order to inhibit peripheral metabolism of levodopa. Carbidopa is an aromatic-L-amino-acid decarboxylase inhibitor with an IC50 of 29 ± 2 μM.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-002152 |
| Pricing | Inquire |
| Cas | 1185134-76-2 |
| Molecular Weight | 231.26 |
| Molecular Formula | C10H9D5N2O4 |
| Canonical SMILES | CC(CC1=CC(=C(C=C1)O)O)(C(=O)O)NN |