4-Benzyloxybenzaldehyde-[7-13C]
4-Benzyloxybenzaldehyde-[7-13C] is the labelled analogue of 4-Benzyloxybenzaldehyde, which is a position isomer of the adenylyl cyclase activator 2-Benzyloxybenzaldehyde. 4-Benzyloxybenzaldehyde also has much less potent anticancer activity against HL-60 cells than its isomeric counterpart.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-010526 |
| Pricing | Inquire |
| Cas | 827308-41-8 |
| Molecular Weight | 213.24 |
| Molecular Formula | C13[13C]H12O2 |
| Canonical SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)C=O |