1-Chloro-2-deoxy-3,5-di-O-toluoyl-a-D-ribofuranose
1-Chloro-2-deoxy-3,5-di-O-toluoyl-α-D-ribofuranose is a vital tool for examining nucleoside analogs and carbohydrate-based entities within the scientific realm. And it is a chemical compound possessing noteworthy significance in the synthesis of diverse pharmaceuticals dedicated to combating a plethora of diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 4330-21-6 |
| Pricing | Inquire |
| Cas | 4330-21-6 |
| Molecular Weight | 388.84 |
| Molecular Formula | C21H21ClO5 |
| Canonical SMILES | CC1=CC=C(C=C1)C(=O)OCC2C(CC(O2)Cl)OC(=O)C3=CC=C(C=C3)C |