3CPLro-IN-1
3CPLro-IN-1 is a potent and orally active inhibitor of SARS-CoV-2 3CLpro with an IC50 of 5.65 μM. 3-Chymotrypsin-like cysteine protease (3CLpro) is an indispensable protein in viral replication and represents an attractive drug target for fighting COVID-19.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2432956-06-2 |
| Pricing | Inquire |
| Cas | 2432956-06-2 |
| Molecular Weight | 435.51 |
| Molecular Formula | C29H25NO3 |
| Canonical SMILES | CC1=C2C(CC3=C(C=CC=C3C2=C(C=C1)O)C4=NC=CC(=C4)C5=CC=CC=C5)COC(=O)C |