(N4-Benzoyl)-5'-O-[(N,N-Diisopropylamino)-(2-Cyanoethoxy)phosphinyl]-3'-O-(4,4'-Dimethoxytrityl)-2'-Deoxycytidine
(N4-Benzoyl)-5'-O-[(N,N-Diisopropylamino)-(2-Cyanoethoxy)phosphinyl]-3'-O-(4,4'-Dimethoxytrityl)-2'-Deoxycytidine, a sophisticated and multifunctional compound at the forefront of biomedical advancements, encompasses a pivotal role in the realm of biomedicine. It stands as an indispensable agent in the combat against an array of ailments.
| Supplier | BOC Sciences |
|---|---|
| Product # | 140712-83-0 |
| Pricing | Inquire |
| Cas | 140712-83-0 |
| Molecular Weight | 849.91 |
| Molecular Formula | C46H52N5O9P |
| Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OCC1C(CC(O1)N2C=CC(=NC2=O)NC(=O)C3=CC=CC=C3)OC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC |