Fmoc-glycine
N-Fmoc-glycine is an N-Fmoc-protected form of Glycine. Glycine is a non-essential amino acid that acts as an inhibitory neyrotransmitter in the vertebrate central nervous system. Glycine also posesses cytoprotective effect against oxidant damage in the kidney.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-003726 |
| Pricing | Inquire |
| Cas | 29022-11-5 |
| Molecular Weight | 297.30 |
| Molecular Formula | C17H15NO4 |
| Canonical SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC(=O)O |