Rosiglitazone-[d4]
Rosiglitazone-[d4] is a labelled compound of Rosiglitazone. Rosiglitazone is a potent antihyperglycemic agent and a potent thiazolidinedione insulin sensitizer with IC50 of 12, 4 and 9 nM for rat, 3T3-L1 and human adipocytes, respectively.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-004158 |
| Pricing | Inquire |
| Cas | 1132641-20-3 |
| Molecular Weight | 361.45 |
| Molecular Formula | C18H15D4N3O3S |
| Canonical SMILES | CN(CCOC1=CC=C(C=C1)CC2C(=O)NC(=O)S2)C3=CC=CC=N3 |