4-Nitrophenyl a-D-maltopyranoside
4-Nitrophenyl a-D-maltopyranoside, a valuable biochemical substrate, has been employed in various analytical studies of alpha-glucosidases from different sources, namely yeast, plants, and bacteria, offering insight into their substrate specificities. This versatile compound can also serve as a powerful tool for identifying inhibitors targeting alpha-glucosidase and glucosidase-related activities.
| Supplier | BOC Sciences |
|---|---|
| Product # | 17400-77-0 |
| Pricing | Inquire |
| Cas | 17400-77-0 |
| Molecular Weight | 463.39 |
| Molecular Formula | C18H25NO13 |
| Canonical SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC2C(C(C(C(O2)CO)OC3C(C(C(C(O3)CO)O)O)O)O)O |