4-Nitrophenyl a-D-maltopentaoside
4-Nitrophenyl α-D-maltopentaoside, a crucial biomedical compound, illuminates the realm of enzymatic reactions and carbohydrate metabolism. Undertaking the role of a glycosidase substrate, it unfurls opportunities to unravel the intricacies of these enzymes' activity. This invaluable resource thrives not only in diagnostic tool and drug development but also in deciphering ailments intertwined with carbohydrate metabolism disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 66068-38-0 |
| Pricing | Inquire |
| Cas | 66068-38-0 |
| Molecular Weight | 949.81 |
| Molecular Formula | C36H55NO28 |
| Canonical SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC2C(C(C(C(O2)CO)OC3C(C(C(C(O3)CO)OC4C(C(C(C(O4)CO)OC5C(C(C(C(O5)CO)OC6C(C(C(C(O6)CO)O)O)O)O)O)O)O)O)O)O)O |