8-Methylguanosine
8-Methylguanosine is a crucial compound in biomedicine used for research purposes. It serves as a building block in the synthesis of nucleic acids and is commonly used in studies investigating RNA metabolism and epitranscriptomics.
| Supplier | BOC Sciences |
|---|---|
| Product # | 36799-17-4 |
| Pricing | Inquire |
| Cas | 36799-17-4 |
| Molecular Weight | 297.27 |
| Molecular Formula | C11H15N5O5 |
| Canonical SMILES | CC1=NC2=C(N1C3C(C(C(O3)CO)O)O)N=C(NC2=O)N |