O-(4-Hydroxy-3,5-diiodophenyl)thyroxine
An impurity of Thyroxine which is one of the two major hormones secreted by the thyroid gland and used to stimulate the consumption of oxygen and thus the metabolism of all cells and tissues in the body.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2694-413570 |
| Pricing | 5 mg/unit USD $1099 |
| Cas | 911661-90-0 |
| Molecular Weight | 1120.77 |
| Molecular Formula | C21H13I6NO5 |
| Canonical SMILES | C1=C(C=C(C(=C1I)OC2=CC(=C(C(=C2)I)OC3=CC(=C(C(=C3)I)O)I)I)I)CC(C(=O)O)N |