5-Bromo-6-chloro-3-indoxyl butyrate
5-Bromo-6-chloro-3-indoxyl butyrate, an indispensable reagent in the field of biomedicine, exhibits immense significance. Its utilization primarily revolves around enzymatic assays aimed at detecting β-galactosidase activity. The application of this product extends to the exploration of lysosomal enzyme deficiencies, specifically in connection to ailments such as Gaucher's disease and Tay-Sachs disease.
| Supplier | BOC Sciences |
|---|---|
| Product # | 873295-29-5 |
| Pricing | Inquire |
| Cas | 873295-29-5 |
| Molecular Weight | 316.58 |
| Molecular Formula | C12H11BrClNO2 |
| Canonical SMILES | CCCC(=O)OC1=CNC2=CC(=C(C=C21)Br)Cl |