N4-benzoyl-5'-O-tert-Butyldimethylsilyl-2'-deoxycytidine
N4-benzoyl-5'-O-tert-Butyldimethylsilyl-2'-deoxycytidine, a potent antitumor agent, offers therapy for an array of cancers like metastatic breast cancer, non-small cell lung cancer, pancreatic cancer, and bladder cancer. Its mechanism of action involves inhibiting DNA synthesis by interrupting the replication of DNA strands. By integrating itself into these strands, it results in premature chain termination. The compound thus offers a promising avenue for cancer therapy.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2706-024745 |
| Pricing | Inquire |
| Cas | 51549-36-1 |
| Molecular Weight | 445.58 |
| Molecular Formula | C22H31N3O5Si |
| Canonical SMILES | CC(C)(C)[Si](C)(C)OCC1C(CC(O1)N2C=CC(=NC2=O)NC(=O)C3=CC=CC=C3)O |