3-Bromo-5-fluoro-2-methoxyphenylboronic acid
3-Bromo-5-fluoro-2-methoxyphenylboronic acid is an intriguing compound that has piqued the interest of the biomedical industry. Imbued with the distinctive traits inherent in boron-containing compounds, it serves as an invaluable asset in the realm of drug discovery. It has good potential in areas such as cancer research, diabetes treatment and inflammation research.
| Supplier | BOC Sciences |
|---|---|
| Product # | 352525-85-0 |
| Pricing | Inquire |
| Cas | 352525-85-0 |
| Molecular Weight | 248.84 |
| Molecular Formula | C7H7BBrFO3 |
| Canonical SMILES | B(C1=CC(=CC(=C1OC)Br)F)(O)O |