5'-Amino-5'-deoxy-2'-O-methyl-5-methyluridine
5'-Amino-5'-deoxy-2'-O-methyl-5-methyluridine, a biomedical agent employed for the therapeutic management of viral ailments including hepatitis C, showcases remarkable antiviral efficacy a result of its capacity to impede viral replication. Its idiosyncratic chemical constitution enables interference with viral RNA synthesis, effectively arresting the advancement of the infection.
| Supplier | BOC Sciences |
|---|---|
| Product # | 251296-69-2 |
| Pricing | Inquire |
| Cas | 251296-69-2 |
| Molecular Weight | 271.27 |
| Molecular Formula | C11H17N3O5 |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2C(C(C(O2)CN)O)OC |