Sampsone B
Sampsone B is a natural compound derived from natural sources. It exhibits promising anti-inflammatory and antitumor activities, making it a potential tool for the research of various inflammatory diseases and cancers.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP5017 |
| Pricing | Inquire |
| Cas | 1309125-17-4 |
| Molecular Weight | 322.315 |
| Molecular Formula | C16H18O7 |
| Canonical SMILES | COC1=CC(=O)C2(C(C1)(OC3=C(O2)C=CC(=C3)OC)OC)OC |