4-Nitrophenyl sulfate potassium salt
Potassium salt of 4-Nitrophenyl sulfate, an essential biomedical entity, holds immense value in combatting a range of ailments. It serves as a pivotal building block for synthesizing pharmaceutical intermediates, facilitating the advancement of anti-cancer medications.
| Supplier | BOC Sciences |
|---|---|
| Product # | 6217-68-1 |
| Pricing | Inquire |
| Cas | 6217-68-1 |
| Molecular Weight | 257.26 |
| Molecular Formula | C6H4KNO6S |
| Canonical SMILES | C1=CC(=CC=C1[N+](=O)[O-])OS(=O)(=O)[O-].[K+] |