Granaticin A
It is produced by the strain of Streptomyces olvaceus var. ETH 7437, Str. violaceoruber. It inhibits the initial stage of RNA biosynthesis, has anti-gram-positive bacteria, Mycobacterium (weak) and vaginal trichomonas activity, but also can inhibit tumor cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 19879-06-2 |
| Pricing | Inquire |
| Cas | 19879-06-2 |
| Molecular Weight | 444.39 |
| Molecular Formula | C22H20O10 |
| Canonical SMILES | CC1C2=C(C3C(O1)CC(=O)O3)C(=C4C(=C2O)C(=O)C5=C(C4=O)C6CC(C5(C(O6)C)O)O)O |