Mono-sec-butyl Phthalate
Mono-sec-butyl Phthalate, can be used as plasticizers in the manufacture of products made of polyvinyl chloride. it has also been shown to activate the nuclear transcription factor peroxisome proliferator-activated receptor-a (PPARa), and PPAR-╬│ (PPAR╬│), and thus having adverse health effects.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB059036 |
| Pricing | Inquire |
| Cas | 53623-59-9 |
| Molecular Weight | 222.24 |
| Molecular Formula | C12H14O4 |
| Canonical SMILES | CCC(C)OC(=O)C1=CC=CC=C1C(=O)O |