RN-18
RN-18, a selective inhibitor of virion infectivity factor (Vif) APOBEC interactions and HIV-1 replication (IC50= 6 μM in nonpermissive H9 cells), antagonizes Vif function and inhibits HIV-1 replication only in the presence of A3G.
| Supplier | BOC Sciences |
|---|---|
| Product # | 431980-38-0 |
| Pricing | Inquire |
| Cas | 431980-38-0 |
| Molecular Weight | 380.42 |
| Molecular Formula | C20H16N2O4S |
| Canonical SMILES | COC1=CC=CC=C1NC(=O)C2=CC=CC=C2SC3=CC=C(C=C3)[N+](=O)[O-] |