Adenostemmoic acid C
Adenostemmoic acid C is an exceedingly robust compound apprehended in sundry plant species used for studying a panoply of ailments, notably cancer, inflammation and cardiovascular disorders, owing to its unparalleled anti-inflammatory and antioxidant attributes.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP1333 |
| Pricing | Inquire |
| Cas | 130217-18-4 |
| Molecular Weight | 368.47 |
| Molecular Formula | C20H32O6 |
| Canonical SMILES | CC12CCCC(C1CCC34C2C(CC(C3)C(C4O)(CO)O)O)(C)C(=O)O |