4-Aminophenyl a-D-mannopyranoside 6-phosphate
4-Aminophenyl a-D-mannopyranoside 6-phosphate is a chemical compound used in the synthesis of phosphoinositide. This product is also used in the study of phosphatidylinositol (PI) signaling pathways, and has been shown to inhibit phospholipase C activity. Additionally, it has been found to be involved in the regulation of insulin secretion.
| Supplier | BOC Sciences |
|---|---|
| Product # | B1370-000873 |
| Pricing | Inquire |
| Cas | 74160-60-4 |
| Molecular Weight | 351.25 |
| Molecular Formula | C12H18NO9P |
| Canonical SMILES | C1=CC(=CC=C1N)OC2C(C(C(C(O2)COP(=O)(O)O)O)O)O |