Methyl 3-O-(a-D-mannopyranosyl)-a-D-mannopyranoside
Methyl 3-O-(a-D-mannopyranosyl)-a-D-mannopyranoside, an indispensable compound in the field of biomedicine, boasts multifarious applications. Its significance lies in its pivotal involvement in the amelioration of ailments associated with carbohydrate metabolism, especially those instigated by mannose-deficient glycoproteins.
| Supplier | BOC Sciences |
|---|---|
| Product # | 72028-62-7 |
| Pricing | Inquire |
| Cas | 72028-62-7 |
| Molecular Weight | 356.32 |
| Molecular Formula | C13H24O11 |
| Canonical SMILES | COC1C(C(C(C(O1)CO)O)OC2C(C(C(C(O2)CO)O)O)O)O |