mPEG9-NHS ester
m-PEG9-NHS ester is a PEG derivative containing an NHS ester. The NHS ester can be used to label the primary amines (-NH2) of proteins, amine-modified oligonucleotides, and other amine-containing molecules. The hydrophilic PEG spacer increases solubility in aqueous media. m-PEG9-NHS ester is a linker for antibody-drug-conjugation (ADC).
Supplier | BOC Sciences |
---|---|
Product # | BADC-00583 |
Pricing | Inquire |
Cas | 1316189-13-5 |
Molecular Weight | 553.6 |
Molecular Formula | C24H43NO13 |
Canonical SMILES | COCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |