Progesterone EP Impurity B
A metabolite of Progesterone.Progesterone is an endogenous steroid and progestogen sex hormone involved in the menstrual cycle, pregnancy, and embryogenesis of humans and other species. Progesterone is also a crucial metabolic intermediate in the production of other endogenous steroids, including the sex hormones and the corticosteroids, and plays an important role in brain function as a neurosteroid.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP6066 |
| Pricing | Inquire |
| Cas | 145-14-2 |
| Molecular Weight | 316.49 |
| Molecular Formula | C21H32O2 |
| Canonical SMILES | CC(C1CCC2C1(CCC3C2CCC4=CC(=O)CCC34C)C)O |