Garcimangosone D
Garcimangosone D, is a naturally occurring compound that is found in the Diospyros kaki leaves. The cytotoxic effects of this compound was tested against various animal cell lines (human A59 cell line, human HT-29 cell line and human Hep G2 cell line).
| Supplier | BOC Sciences |
|---|---|
| Product # | 356055-68-0 |
| Pricing | Inquire |
| Cas | 356055-68-0 |
| Molecular Weight | 392.36 |
| Molecular Formula | C19H20O9 |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)C2=C(C=C(C=C2OC3C(C(C(C(O3)CO)O)O)O)O)O |