Cresyl Diphenyl Phosphate
Cresyl Diphenyl Phosphate is a flame retardant compound extensively used in the biomedical industry. With its excellent heat resistance and high stability, it finds applications in the development of drugs targeting specific diseases. This compound is particularly effective in treating neurodegenerative disorders, including Alzheimer's and Parkinson's diseases. It exhibits remarkable potential in promoting the development of novel therapeutics for these debilitating conditions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 26444-49-5 |
| Pricing | Inquire |
| Cas | 26444-49-5 |
| Molecular Weight | 340.31 |
| Molecular Formula | C19H17O4P |
| Canonical SMILES | CC1=CC=C(C=C1)OP(=O)(OC2=CC=CC=C2)OC3=CC=CC=C3 |