C3a Receptor Agonist
Complement 3a (C3a) Receptor Agonist is a G protein-coupled receptor protein involved in the complement system complement pathway. C3aRs are expressed on neural progenitor cells and immature neurons in adult mice. It stimulates differentiation of neural progenitor cells in vitro.
| Supplier | BOC Sciences |
|---|---|
| Product # | 944997-60-8 |
| Pricing | Inquire |
| Cas | 944997-60-8 |
| Molecular Weight | 433.6 |
| Molecular Formula | C27H35N3O2 |
| Canonical SMILES | O=C(N1CCC(NC(C(C2CCCCC2)C3=CC=CC=C3)=O)CC1)CCC4=CC=CN=C4 |