Methyl 2,6-di-O-p-toluenesulfonyl-D-glucopyranoside
Methyl 2,6-di-O-p-toluenesulfonyl-D-glucopyranoside is a compound acting as a protective compound for drugs, preserving their stability and enhancing their pharmacological activity. Additionally, it finds applications in research related to various diseases, particularly those involving carbohydrate metabolism.
| Supplier | BOC Sciences |
|---|---|
| Product # | 54497-89-1 |
| Pricing | Inquire |
| Cas | 54497-89-1 |
| Molecular Weight | 502.56 |
| Molecular Formula | C21H26O10S2 |
| Canonical SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC2C(C(C(C(O2)OC)OS(=O)(=O)C3=CC=C(C=C3)C)O)O |