2'-O,4'-C-Methyleneuridine
2'-O,4'-C-Methyleneuridine, a biomedical compound, plays a pivotal role in the advancement of antiviral drugs and therapeutics. Its profound efficacy against a wide array of viral infections, namely hepatitis C virus (HCV) and respiratory syncytial virus (RSV), unveils its tremendous potential in combatting viral diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 200435-92-3 |
| Pricing | Inquire |
| Cas | 200435-92-3 |
| Molecular Weight | 256.21 |
| Molecular Formula | C10H12N2O6 |
| Canonical SMILES | C1C2(C(C(O1)C(O2)N3C=CC(=O)NC3=O)O)CO |