O-Desmethyl Indomethacin-[d4]
O-Desmethyl Indomethacin-[d4], is the labelled analogue of O-Desmethyl Indomethacin, which is a metabolite of Indomethacin. Indometacin is a nonsteroidal anti-inflammatory drug commonly used as a prescription medication to reduce fever, pain, stiffness, and swelling from inflammation.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-003635 |
| Pricing | Inquire |
| Cas | 1189916-55-9 |
| Molecular Weight | 347.79 |
| Molecular Formula | C18H10D4ClNO4 |
| Canonical SMILES | CC1=C(C2=C(N1C(=O)C3=CC=C(C=C3)Cl)C=CC(=C2)O)CC(=O)O |