4-Hydroxy-2,3-dimethoxyxanthone
4-Hydroxy-2,3-dimethoxyxanthone is a remarkable and multifaceted natural compound discovered in diverse botanical sources. This potent entity exhibits extraordinary anti-inflammatory and antioxidant attributes, aiding in studying a spectrum of complex inflammatory ailments, notably including rheumatoid arthritand asthma.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP7300 |
| Pricing | Inquire |
| Cas | 10527-38-5 |
| Molecular Weight | 272.256 |
| Molecular Formula | C15H12O5 |
| Canonical SMILES | COC1=C(C(=C2C(=C1)C(=O)C3=CC=CC=C3O2)O)OC |