CP-533536
CP-533536, also called as Evatanepag, a 3-pyridyl sulfonamide compound, demonstrated excellent in vitro potency against prostaglandin E2 (PGE2) (induces local bone formation with EC50= 0.3 nM) and selectivity against a broad panel of other targets.
| Supplier | BOC Sciences |
|---|---|
| Product # | 223488-57-1 |
| Pricing | Inquire |
| Cas | 223488-57-1 |
| Molecular Weight | 468.56 |
| Molecular Formula | C25H28N2O5S |
| Canonical SMILES | CC(C)(C)C1=CC=C(C=C1)CN(CC2=CC(=CC=C2)OCC(=O)O)S(=O)(=O)C3=CN=CC=C3 |