6-Methyl-thio-guanosine
6-Methyl-thio-guanosine is a remarkable biomedical concoction widely employed as a nucleoside analog in research of viral infestations, namely hepatitis C and influenza. Displays a formidable arsenal of antiviral capabilities, it efficaciously impedes viral recompoundion through its assimilation into the viral RNA strand, thereby forestalling the intricate process of enhancement.
| Supplier | BOC Sciences |
|---|---|
| Product # | 4914-73-2 |
| Pricing | Inquire |
| Cas | 4914-73-2 |
| Molecular Weight | 313.33 |
| Molecular Formula | C11H15N5O4S |
| Canonical SMILES | CSC1=NC(=NC2=C1N=CN2C3C(C(C(O3)CO)O)O)N |