3',5'-Di-O-acetyl-5-fluoro-O4-(2,4,6-trimethylphenyl)-2'-deoxyuridine
3',5'-Di-O-acetyl-5-fluoro-O4-(2,4,6-trimethylphenyl)-2'-deoxyuridine is a highly efficacious antiviral compound, finding extensive application within the biomedical domain for research of viral infections associated with herpes simplex virus (HSV) and varicella-zoster virus (VZV). Its synthetic nature, reminiscent of nucleoside analogues, effectively curtails viral DNA replication via active integration into the nascent DNA strand. This consequential molecular interplay culminates in the termination of the DNA chain, concurrently stifling viral progression.
| Supplier | BOC Sciences |
|---|---|
| Product # | 141120-62-9 |
| Pricing | Inquire |
| Cas | 141120-62-9 |
| Molecular Weight | 448.45 |
| Molecular Formula | C22H25FN2O7 |
| Canonical SMILES | CC1=CC(=C(C(=C1)C)OC2=NC(=O)N(C=C2F)C3CC(C(O3)COC(=O)C)OC(=O)C)C |