Venlafaxine EP Impurity F
Venlafaxine EP Impurity F is an impurity of Venlafaxine, which is an antidepressant medication of the serotonin-norepinephrine reuptake inhibitor (SNRI) class used to treat major depressive disorder, generalized anxiety disorder, panic disorder, and social anxiety disorder.
| Supplier | BOC Sciences |
|---|---|
| Product # | 93413-57-1 |
| Pricing | Inquire |
| Cas | 93413-57-1 |
| Molecular Weight | 259.39 |
| Molecular Formula | C17H25NO |
| Canonical SMILES | CN(C)CC(C1=CCCCC1)C2=CC=C(C=C2)OC |