Glycodeoxycholic acid-[2,2,4,4-d4]
Glycodeoxycholic acid-2,2,4,4-[d4] is the labelled analogue of Glycodeoxycholic acid. Glycodeoxycholic acid is a bile acid formed in the liver by the conjugation of deoxycholate with glycine. Glycodeoxycholic acid can be used as a cholagogue and choleretic.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-001660 |
| Pricing | Inquire |
| Cas | 1069132-37-1 |
| Molecular Weight | 453.65 |
| Molecular Formula | C26H39D4NO5 |
| Canonical SMILES | CC(CCC(=O)NCC(=O)O)C1CCC2C1(C(CC3C2CCC4C3(CCC(C4)O)C)O)C |