2-ISOBUTOXY-5-METHYLPHENYLBORONIC ACID
2-ISOBUTOXY-5-METHYLPHENYLBORONIC ACID is a crucial compound used in biomedicine and is employed as a reagent in organic synthesis and pharmaceutical research. Its exceptional properties make it an effective tool for developing potential drugs to address various diseases, including cancer and diabetes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 870778-94-2 |
| Pricing | Inquire |
| Cas | 870778-94-2 |
| Molecular Formula | C11H17BO3 |
| Canonical SMILES | B(C1=C(C=CC(=C1)C)OCC(C)C)(O)O |