Venlafaxine EP Impurity B hydrochloride
Venlafaxine EP Impurity B hydrochloride is an impurity of Venlafaxine, which is an antidepressant medication of the serotonin-norepinephrine reuptake inhibitor (SNRI) class used to treat major depressive disorder, generalized anxiety disorder, panic disorder, and social anxiety disorder.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2174001-92-2 |
| Pricing | Inquire |
| Cas | 2174001-92-2 |
| Molecular Weight | 287.78 |
| Molecular Formula | C14H22ClNO3 |
| Canonical SMILES | CCOC(=O)C(CN(C)C)C1=CC=C(C=C1)OC.Cl |