5-O-(tert-Butyldimethylsilyl)-2,3-O-isopropylidene-2-C-methyl-D-ribono-1,4-lactone
5-O-(tert-Butyldimethylsilyl)-2,3-O-isopropylidene-2-C-methyl-D-ribono-1,4-lactone is a chemical compound that plays a crucial role in the biomedical industry. Specifically, it is employed in the synthesis of antiviral and anti-inflammatory drugs targeting HIV and Hepatitis C, as well as therapeutics aimed at treating cancer and cardiovascular diseases. Its profound impact on these fields is undeniable, and its potential for further medical breakthroughs remains a subject of extensive study and experimentation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1272971-27-3 |
| Pricing | Inquire |
| Cas | 1272971-27-3 |
| Molecular Weight | 316.47 |
| Molecular Formula | C15H28O5Si |
| Canonical SMILES | CC1(OC2C(OC(=O)C2(O1)C)CO[Si](C)(C)C(C)(C)C)C |