Juglomycin B
Juglomycin B is originally isolated from Str. distatochromogenes var. juglonensis 190-2. It has a broad spectrum of antibacterial and mycobacterial effects, and has the effect of inhibiting ehrlician ascites cancer in mice and prolongating life with 1 mg/kg.
Supplier | BOC Sciences |
---|---|
Product # | BBF-01524 |
Pricing | Inquire |
Cas | 38637-89-7 |
Molecular Weight | 274.22 |
Molecular Formula | C14H10O6 |
Canonical SMILES | C1C(C(OC1=O)C2=CC(=O)C3=C(C2=O)C=CC=C3O)O |