5'-Biotin CE Phosphoramidite
5'-Biotin Phosphoramidite for direct labeling of synthetic oligonucleotides has the following characteristics:
Soluble in acetonitrile at concentrations useful for DNA synthesis.
Include the DMT group used for cassette purification, which is essential for the preparation of biotinylated PCR primers because cross-contamination may occur during HPLC purification.
To develop diagnostic probes, biotin phosphoramidite can be branched to allow the introduction of multiple biotins at the 3'or 5'end.
Soluble in acetonitrile at concentrations useful for DNA synthesis.
Include the DMT group used for cassette purification, which is essential for the preparation of biotinylated PCR primers because cross-contamination may occur during HPLC purification.
To develop diagnostic probes, biotin phosphoramidite can be branched to allow the introduction of multiple biotins at the 3'or 5'end.
| Supplier | BOC Sciences |
|---|---|
| Product # | 135137-87-0 |
| Pricing | Inquire |
| Cas | 135137-87-0 |
| Molecular Weight | 846.08 |
| Molecular Formula | C46H64N5O6PS |
| Canonical SMILES | CC(C)N(C(C)C)P(OCCCCCCNC(=O)CCCCC1C2C(CS1)N(C(=O)N2)C(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC)OCCC#N |