Epoxyquinomicin B
Epoxyquinomicin B is an antibiotic produced by Amycolatopsis sp. MK299-95F4. It has moderate antibacterial activity against Pasteurella. It has a strong inhibitory effect on arthritis induced by oral collagen and is cytotoxic to several tumor cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-00857 |
| Pricing | Inquire |
| Cas | 175448-32-5 |
| Molecular Weight | 289.24 |
| Molecular Formula | C14H11NO6 |
| Canonical SMILES | C1=CC=C(C(=C1)C(=O)NC2=CC(=O)C3(C(C2=O)O3)CO)O |