24, 25-Dihydroxy Vitamin D3
24, 25-Dihydroxy VD3 is a compound which is closely related to 1,25-dihydroxyvitamin D3, the active form of vitamin D3, but like vitamin D3 itself and 25-hydroxyvitamin D3 is inactive as a hormone both in vitro and in vivo.
| Supplier | BOC Sciences |
|---|---|
| Product # | 40013-87-4 |
| Pricing | Inquire |
| Cas | 40013-87-4 |
| Molecular Weight | 416.64 |
| Molecular Formula | C27H44O3 |
| Canonical SMILES | CC(CCC(C(C)(C)O)O)C1CCC2C1(CCCC2=CC=C3CC(CCC3=C)O)C |