2-Acetamido-2-deoxy-3-O-(2-acetamido-2-deoxy-a-D-galactopyranosyl)-D-galactopyranose
2-Acetamido-2-deoxy-3-O-(2-acetamido-2-deoxy-α-D-galactopyranosyl)-D-galactopyranose is a compound widely employed in the biomedical sector, exhibiting implications for the reserch of specific ailments engendered by pathogenic microorganisms. Its remarkable configuration and characteristics render it an auspicious contender for the pharmaceutical domain, particularly in regard to antimicrobial therapeutics engineered to battle bacterial contagions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 62026-07-7 |
| Pricing | Inquire |
| Cas | 62026-07-7 |
| Molecular Weight | 424.40 |
| Molecular Formula | C16H28N2O11 |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1OC2C(C(OC(C2O)CO)O)NC(=O)C)CO)O)O |