methyl 1-phenylethanesulfonate
An impurity of Cefadroxil. It is produced by the strain of Semisynthetic first generation oral cephalosporin. Its antimicrobial spectrum is the same as cefalexin, but its blood concentration is higher and longer than cefalexin. It is used to treat urinary tract infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 883835-57-2 |
| Pricing | Inquire |
| Cas | 883835-57-2 |
| Molecular Weight | 200.25 |
| Molecular Formula | C9H12O3S |
| Canonical SMILES | CC(C1=CC=CC=C1)S(=O)(=O)OC |