DIBROMOMALEIC ACID
Dibromomaleic acid is a chemical compound commonly used in the biomedical industry. It exhibits therapeutic potential in the drug development of various diseases, including certain types of cancer, through its anti-proliferative and anti-inflammatory properties. It can also be utilized as a key reagent in organic synthesis for the development of pharmaceuticals and other biologically active compounds.
| Supplier | BOC Sciences |
|---|---|
| Product # | 608-37-7 |
| Pricing | Inquire |
| Cas | 608-37-7 |
| Molecular Weight | 273.86 |
| Molecular Formula | C4H2Br2O4 |
| Canonical SMILES | C(=C(C(=O)O)Br)(C(=O)O)Br |