2-butoxy-7-[[4-(1-pyrrolidinylmethyl)phenyl]methyl]-5H-pyrrolo[3,2-d]pyrimidin-4-amine
2-butoxy-7-[[4-(1-pyrrolidinylmethyl)phenyl]methyl]-5H-pyrrolo[3,2-d]pyrimidin-4-amine, a medicinal molecule known for its kinase-inhibiting properties, has been identified as a potential candidate for cancer therapy due to its unique ability to induce apoptosis and inhibit the proliferation of malignant cells. With promising applications in the treatment of leukemia and lung cancer, this small-molecule inhibitor has the potential to address critical unmet clinical needs in cancer management. Its effectiveness and suitability as a therapeutic intervention call for further investigation in the field of oncology.
| Supplier | BOC Sciences |
|---|---|
| Product # | B0001-008679 |
| Pricing | Inquire |
| Cas | 1878111-20-6 |
| Molecular Weight | 379.51 |
| Molecular Formula | C22H29N5O |
| Canonical SMILES | CCCCOC1=NC2=C(C(=N1)N)NC=C2CC3=CC=C(C=C3)CN4CCCC4 |