Octyl 2-acetamido-2-deoxy-b-D-glucopyranoside
Octyl 2-acetamido-2-deoxy-b-D-glucopyranoside is a vital compound widely used in the biomedical industry. Its unique properties make it a crucial ingredient in pharmaceutical formulations. This product is commonly employed as a non-ionic detergent, facilitating the solubilization and purification of various membrane proteins. Its applications extend to the study and development of drugs targeting specific diseases, such as cancer and infectious diseases.
Supplier | BOC Sciences |
---|---|
Product # | 147126-58-7 |
Pricing | Inquire |
Cas | 147126-58-7 |
Molecular Weight | 333.42 |
Molecular Formula | C16H31NO6 |
Canonical SMILES | CCCCCCCCOC1C(C(C(C(O1)CO)O)O)NC(=O)C |